| Compound Information | SONAR Target prediction |
| Name: | 6,3`-DIMETHOXYFLAVONE |
| Unique Identifier: | SPE01504132 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C17H14O4 |
| Molecular Weight: | 268.18 g/mol |
| X log p: | 17.421 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 44.76 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | COc1cccc(c1)C1Oc2ccc(OC)cc2C(=O)C=1 |
| Source: | ex Pimelia decora |
| Reference: | Aust J Chem 34: 1779 (1981) |
| Found: 18 active | as graph: single | with analogs | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | BIK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7584±0.0247487 |
| Normalized OD Score: sc h | 1.1034±0.0295941 |
| Z-Score: | 4.5381±1.33309 |
| p-Value: | 0.000161944 |
| Z-Factor: | -0.801503 |
| Fitness Defect: | 8.7283 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 676293 | 6-methoxy-2-(3-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 2 |
| SPE01500741 | 0.9122 |
| JFD 02324 | 0.9507 |
| nonactive | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | 1 2 Next >> |
| SPE01505139 | 0.42 |
| LAT006E05 | 0.403846153846154 |
| LOPAC 01174 | 0.403846153846154 |
| BTB 13702 | 0.347826086956522 |
| SPE01500735 | 0.326530612244898 |
| SPE01500741 | 0.295454545454545 |
Service provided by the
Mike Tyers Laboratory