| Compound Information | SONAR Target prediction | | Name: | 6,3`-DIMETHOXYFLAVONE | | Unique Identifier: | SPE01504132 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cccc(c1)C1Oc2ccc(OC)cc2C(=O)C=1 | | Source: | ex Pimelia decora | | Reference: | Aust J Chem 34: 1779 (1981) |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6191±0.0013435 |
| Normalized OD Score: sc h |
1.1042±0.002816 |
| Z-Score: |
4.5974±0.353926 |
| p-Value: |
0.00000751926 |
| Z-Factor: |
-3.3857 |
| Fitness Defect: |
11.798 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|E10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.60 Celcius | | Date: | 2007-09-27 YYYY-MM-DD | | Plate CH Control (+): | 0.03955±0.00134 | | Plate DMSO Control (-): | 0.544125±0.13026 | | Plate Z-Factor: | 0.1622 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 676293 |
6-methoxy-2-(3-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | 1 2 Next >> |
|
