Compound Information | SONAR Target prediction | Name: | 3,7-DIHYDROXYFLAVONE | Unique Identifier: | SPE01504130 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 244.158 g/mol | X log p: | 17.144 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc2C(=O)C(O)=C(Oc2c1)c1ccccc1 | Class: | flavone | Source: | Platymiscium praecox | Reference: | Phytochemistry 11: 3515 (1972) |
Species: |
4932 |
Condition: |
GCN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.1780±0.00360624 |
Normalized OD Score: sc h |
0.7012±0.0149826 |
Z-Score: |
-5.1222±0.2919 |
p-Value: |
0.000000491618 |
Z-Factor: |
0.00828427 |
Fitness Defect: |
14.5256 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2007-10-30 YYYY-MM-DD | Plate CH Control (+): | 0.041175±0.00059 | Plate DMSO Control (-): | 0.255025±0.02158 | Plate Z-Factor: | 0.7016 |
| png ps pdf |
DBLink | Rows returned: 2 | |
5393152 |
3,7-dihydroxy-2-phenyl-chromen-4-one |
5702881 |
3,7-dihydroxy-2-phenyl-chromen-4-one hydrate |
internal high similarity DBLink | Rows returned: 12 | 1 2 Next >> |
active | Cluster 15563 | Additional Members: 8 | Rows returned: 2 | |
|