| Compound Information | SONAR Target prediction | | Name: | 3,7-DIHYDROXYFLAVONE | | Unique Identifier: | SPE01504130 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 17.144 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc2C(=O)C(O)=C(Oc2c1)c1ccccc1 | | Class: | flavone | | Source: | Platymiscium praecox | | Reference: | Phytochemistry 11: 3515 (1972) |
| Species: |
4932 |
| Condition: |
COT1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6277±0.00346482 |
| Normalized OD Score: sc h |
0.9031±0.00209003 |
| Z-Score: |
-5.0254±0.172354 |
| p-Value: |
0.00000060291 |
| Z-Factor: |
0.146249 |
| Fitness Defect: |
14.3215 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 7|A8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.70 Celcius | | Date: | 2007-11-20 YYYY-MM-DD | | Plate CH Control (+): | 0.040825±0.00080 | | Plate DMSO Control (-): | 0.6803250000000001±0.01672 | | Plate Z-Factor: | 0.9229 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 5393152 |
3,7-dihydroxy-2-phenyl-chromen-4-one |
| 5702881 |
3,7-dihydroxy-2-phenyl-chromen-4-one hydrate |
| internal high similarity DBLink | Rows returned: 12 | 1 2 Next >> |
| active | Cluster 15563 | Additional Members: 8 | Rows returned: 2 | |
|
