| 
 | Compound Information | SONAR Target prediction |  | Name: | 3,7-DIHYDROXYFLAVONE |  | Unique Identifier: | SPE01504130 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 17.144  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1ccc2C(=O)C(O)=C(Oc2c1)c1ccccc1 |  | Class: | flavone |  | Source: | Platymiscium praecox |  | Reference: | Phytochemistry 11: 3515 (1972) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BNI4 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.3203±0.0416486 |  
		| Normalized OD Score: sc h | 0.4789±0.0405689 |  
		| Z-Score: | -16.1230±0.0229847 |  
		| p-Value: | 0 |  
		| Z-Factor: | 0.648501 |  
		| Fitness Defect: | INF |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|A8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.20 Celcius |  | Date: | 2006-03-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.038875±0.00072 |  | Plate DMSO Control (-): | 0.640475±0.01360 |  | Plate Z-Factor: | 0.9521 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 2 |  | 
 
	
		| 5393152 | 3,7-dihydroxy-2-phenyl-chromen-4-one |  
		| 5702881 | 3,7-dihydroxy-2-phenyl-chromen-4-one hydrate |  
 | internal high similarity DBLink  | Rows returned: 12 | << Back 1 2 | 
 
 | active | Cluster 15563 | Additional Members: 8 | Rows returned: 2 |  | 
 
 |