| Compound Information | SONAR Target prediction |  | Name: | 3,7-DIHYDROXYFLAVONE |  | Unique Identifier: | SPE01504130  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 17.144  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1ccc2C(=O)C(O)=C(Oc2c1)c1ccccc1 |  | Class: | flavone |  | Source: | Platymiscium praecox |  | Reference: | Phytochemistry 11: 3515 (1972) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MCM21 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4770±0.010253 | 
	 
	
		| Normalized OD Score: sc h | 
		0.7083±0.0098624 | 
	 
	
		| Z-Score: | 
		-14.3108±0.281851 | 
	 
	
		| p-Value: | 
		2.8026e-45 | 
	 
	
		| Z-Factor: | 
		0.651031 | 
	 
	
		| Fitness Defect: | 
		102.5858 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|A8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.90 Celcius |  | Date: | 2007-11-07 YYYY-MM-DD |  | Plate CH Control (+): | 0.040975±0.00078 |  | Plate DMSO Control (-): | 0.658125±0.01556 |  | Plate Z-Factor: | 0.9208 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 5393152 | 
		3,7-dihydroxy-2-phenyl-chromen-4-one | 
	 
	
		| 5702881 | 
		3,7-dihydroxy-2-phenyl-chromen-4-one hydrate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 12 | 1 2 Next >>  |   
 |  active | Cluster 15563 | Additional Members: 8 | Rows returned: 2 |  |   
 
 |