| Compound Information | SONAR Target prediction |  | Name: | DIFFRACTAIC ACID |  | Unique Identifier: | SPE01504118  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.21 g/mol |  | X log p: | 4.4  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 61.83 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(C(O)=O)c(O)c2C)c(OC)c1C |  | Class: | depside |  | Source: | Usnea spp |  | Reference: | Chem Ber 65: 175, 1668 (1932) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		TEP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6556±0.00403051 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0294±0.00961132 | 
	 
	
		| Z-Score: | 
		0.7937±0.304417 | 
	 
	
		| p-Value: | 
		0.437964 | 
	 
	
		| Z-Factor: | 
		-2.10159 | 
	 
	
		| Fitness Defect: | 
		0.8256 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 9|C3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.40 Celcius |  | Date: | 2005-12-23 YYYY-MM-DD |  | Plate CH Control (+): | 0.039075±0.00117 |  | Plate DMSO Control (-): | 0.618675±0.01681 |  | Plate Z-Factor: | 0.8971 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 6 |  |  
 
	
		| 94870 | 
		4-(2,4-dimethoxy-3,6-dimethyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid | 
	 
	
		| 135219 | 
		4-[4-(2,4-dihydroxy-3,5,6-trimethyl-benzoyl)oxy-2-methoxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3,5,6-tr imethyl-benzoic acid | 
	 
	
		| 155686 | 
		4-[4-(2,4-dihydroxy-3,6-dimethyl-benzoyl)oxy-2-methoxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3,5,6-trime thyl-benzoic acid | 
	 
	
		| 157810 | 
		4-[2-hydroxy-4-(4-hydroxy-2-methoxy-3,5,6-trimethyl-benzoyl)oxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3, 5,6-trimethyl-benzoic acid | 
	 
	
		| 371612 | 
		(3-methoxy-2,5,6-trimethyl-phenyl) 2,4-dimethoxy-3,5,6-trimethyl-benzoate | 
	 
	
		| 1551040 | 
		4-(2,4-dimethoxy-3,6-dimethyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 |  |   
 
 |