| 
 | Compound Information | SONAR Target prediction |  | Name: | DIFFRACTAIC ACID |  | Unique Identifier: | SPE01504118 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.21 g/mol |  | X log p: | 4.4  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 61.83 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(C(O)=O)c(O)c2C)c(OC)c1C |  | Class: | depside |  | Source: | Usnea spp |  | Reference: | Chem Ber 65: 175, 1668 (1932) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SRS2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7027±0.00388909 |  
		| Normalized OD Score: sc h | 0.9830±0.0048728 |  
		| Z-Score: | -0.8327±0.247071 |  
		| p-Value: | 0.412142 |  
		| Z-Factor: | -3.78815 |  
		| Fitness Defect: | 0.8864 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 22|G6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.30 Celcius |  | Date: | 2008-01-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.042225±0.00052 |  | Plate DMSO Control (-): | 0.6784250000000001±0.01655 |  | Plate Z-Factor: | 0.9217 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 6 |  | 
 
	
		| 94870 | 4-(2,4-dimethoxy-3,6-dimethyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid |  
		| 135219 | 4-[4-(2,4-dihydroxy-3,5,6-trimethyl-benzoyl)oxy-2-methoxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3,5,6-tr imethyl-benzoic acid
 |  
		| 155686 | 4-[4-(2,4-dihydroxy-3,6-dimethyl-benzoyl)oxy-2-methoxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3,5,6-trime thyl-benzoic acid
 |  
		| 157810 | 4-[2-hydroxy-4-(4-hydroxy-2-methoxy-3,5,6-trimethyl-benzoyl)oxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3, 5,6-trimethyl-benzoic acid
 |  
		| 371612 | (3-methoxy-2,5,6-trimethyl-phenyl) 2,4-dimethoxy-3,5,6-trimethyl-benzoate |  
		| 1551040 | 4-(2,4-dimethoxy-3,6-dimethyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoate |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 |  | 
 
 |