Compound Information | SONAR Target prediction | Name: | DIFFRACTAIC ACID | Unique Identifier: | SPE01504118 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.21 g/mol | X log p: | 4.4 (online calculus) | Lipinksi Failures | 0 | TPSA | 61.83 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 6 | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(C(O)=O)c(O)c2C)c(OC)c1C | Class: | depside | Source: | Usnea spp | Reference: | Chem Ber 65: 175, 1668 (1932) |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.9030±0.00318198 |
Normalized OD Score: sc h |
0.9829±0.00334495 |
Z-Score: |
0.5509±0.151931 |
p-Value: |
0.583854 |
Z-Factor: |
-2.6968 |
Fitness Defect: |
0.5381 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 19|H9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2012-05-28 YYYY-MM-DD | Plate CH Control (+): | 0.09750000000000002±0.00206 | Plate DMSO Control (-): | 0.9365000000000001±0.02296 | Plate Z-Factor: | 0.9105 |
| png ps pdf |
DBLink | Rows returned: 6 | |
94870 |
4-(2,4-dimethoxy-3,6-dimethyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid |
135219 |
4-[4-(2,4-dihydroxy-3,5,6-trimethyl-benzoyl)oxy-2-methoxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3,5,6-tr imethyl-benzoic acid |
155686 |
4-[4-(2,4-dihydroxy-3,6-dimethyl-benzoyl)oxy-2-methoxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3,5,6-trime thyl-benzoic acid |
157810 |
4-[2-hydroxy-4-(4-hydroxy-2-methoxy-3,5,6-trimethyl-benzoyl)oxy-3,5,6-trimethyl-benzoyl]oxy-2-methoxy-3, 5,6-trimethyl-benzoic acid |
371612 |
(3-methoxy-2,5,6-trimethyl-phenyl) 2,4-dimethoxy-3,5,6-trimethyl-benzoate |
1551040 |
4-(2,4-dimethoxy-3,6-dimethyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 | |
|