| Compound Information | SONAR Target prediction |  | Name: | HIERACIN |  | Unique Identifier: | SPE01504115  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 292.156 g/mol |  | X log p: | 11.519  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1cc(O)c(O)c(O)c1 |  | Class: | flavone |  | Source: | Ginkgo biloba, Hieracium pilosella and Isoetes spp |  | Reference: | Chem Pharm Bull 32:4935 (1984) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		CHS3 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5849±0.00190919 | 
	 
	
		| Normalized OD Score: sc h | 
		0.8973±0.00682285 | 
	 
	
		| Z-Score: | 
		-4.7506±0.202122 | 
	 
	
		| p-Value: | 
		0.0000025312 | 
	 
	
		| Z-Factor: | 
		0.056895 | 
	 
	
		| Fitness Defect: | 
		12.8868 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 17|F6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.10 Celcius |  | Date: | 2008-06-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.040175±0.00056 |  | Plate DMSO Control (-): | 0.646325±0.01547 |  | Plate Z-Factor: | 0.9160 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 5280445 | 
		2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one | 
	 
	
		| 5281701 | 
		5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 16 | 1 2 3 Next >>  |   
 |  active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 |  |   
 
 |