| Compound Information | SONAR Target prediction | | Name: | HIERACIN | | Unique Identifier: | SPE01504115 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 292.156 g/mol | | X log p: | 11.519 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1cc(O)c(O)c(O)c1 | | Class: | flavone | | Source: | Ginkgo biloba, Hieracium pilosella and Isoetes spp | | Reference: | Chem Pharm Bull 32:4935 (1984) |
| Species: |
4932 |
| Condition: |
RSA3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6004±0.00756604 |
| Normalized OD Score: sc h |
0.9284±0.0208358 |
| Z-Score: |
-3.0694±0.878414 |
| p-Value: |
0.0072881 |
| Z-Factor: |
-3.44323 |
| Fitness Defect: |
4.9215 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 17|F6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.80 Celcius | | Date: | 2008-04-01 YYYY-MM-DD | | Plate CH Control (+): | 0.040075±0.00056 | | Plate DMSO Control (-): | 0.6640999999999999±0.03339 | | Plate Z-Factor: | 0.8443 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 5280445 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one |
| 5281701 |
5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 16 | 1 2 3 Next >> |
| active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 | |
|