| Compound Information | SONAR Target prediction |  | Name: | DIHYDROCELASTROL |  | Unique Identifier: | SPE01504082  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 412.308 g/mol |  | X log p: | 3.904  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Cc1c(O)c(O)cc2c1CC=C1C2(C)CCC2(C)C3CC(C)(CCC3(C)CCC12C)C(O)=O |  | Class: | triterpene |  | Source: | celastrol derivative |  | Reference: | J Org Chem 30: 1729 (1965) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE01501116 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4538±0.00947523 | 
	 
	
		| Normalized OD Score: sc h | 
		0.7531±0.00322121 | 
	 
	
		| Z-Score: | 
		-6.5761±1.36972 | 
	 
	
		| p-Value: | 
		0.0000000102622 | 
	 
	
		| Z-Factor: | 
		-1.41863 | 
	 
	
		| Fitness Defect: | 
		18.3948 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|G4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.10 Celcius |  | Date: | 2006-11-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.0401±0.00288 |  | Plate DMSO Control (-): | 0.675225±0.19890 |  | Plate Z-Factor: | 0.3651 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 5029154 | 
		10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid | 
	 
	
		| 6708673 | 
		(2R,4aR,6aS,6aR,14aS)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picen e-2-carboxylic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 3682 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |