| Compound Information | SONAR Target prediction |  | Name: | UVAOL |  | Unique Identifier: | SPE01504073  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 392.32 g/mol |  | X log p: | 2.292  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |  | Class: | triterpene |  | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia |  | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) |  | Therapeutics: | antineoplastic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		TOP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.3827±0.0227688 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0701±0.0189359 | 
	 
	
		| Z-Score: | 
		0.6049±0.126568 | 
	 
	
		| p-Value: | 
		0.546884 | 
	 
	
		| Z-Factor: | 
		-1.69861 | 
	 
	
		| Fitness Defect: | 
		0.6035 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 8|D7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.00 Celcius |  | Date: | 2006-04-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.0402±0.00175 |  | Plate DMSO Control (-): | 0.3543±0.01300 |  | Plate Z-Factor: | 0.8566 |  
  |  png ps pdf |  
 
 
	
		| 5315135 | 
		(3S,6aR,8S,8aS,12S,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradec ahydro-1H-picene-3,8-diol | 
	 
	
		| 5315144 | 
		(3S,6aR,8aS,12S,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,1 4,14a-tetradecahydro-1H-picen-3-ol | 
	 
	
		| 5317072 | 
		2-[(2R)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol | 
	 
	
		| 5317209 | 
		(3S,6aR,8aS,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a -tetradecahydropicen-3-ol | 
	 
	
		| 5317268 | 
		(2S,4aR)-4a,8-dimethyl-2-propan-2-yl-1,3,4,5,6,8a-hexahydronaphthalen-2-ol | 
	 
	
		| 5320272 | 
		(3R,6aR,8S,8aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydr opicene-3,8-diol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 9 | 1 2 Next >>  |   
 |  active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 |  |   
 
 |