| 
 | Compound Information | SONAR Target prediction |  | Name: | UVAOL |  | Unique Identifier: | SPE01504073 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 392.32 g/mol |  | X log p: | 2.292  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |  | Class: | triterpene |  | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia
 |  | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967)
 |  | Therapeutics: | antineoplastic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MRC1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6953±0.00692965 |  
		| Normalized OD Score: sc h | 1.0039±0.00492224 |  
		| Z-Score: | 0.1879±0.238825 |  
		| p-Value: | 0.85304 |  
		| Z-Factor: | -22.9605 |  
		| Fitness Defect: | 0.1589 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 11|G10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.70 Celcius |  | Date: | 2008-01-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.044025±0.00037 |  | Plate DMSO Control (-): | 0.666225±0.01697 |  | Plate Z-Factor: | 0.9121 | 
 |  png ps
 pdf
 | 
 
 
	
		| 620492 | 10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-o l
 |  
		| 625091 | 1-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanol |  
		| 3266408 | 8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1 H-picen-3-ol
 |  
		| 3532694 | 17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta [a]phenanthren-3-ol
 |  
		| 5270607 | (3S,6aR,6bS,8S,8aS,11R,12S,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a- tetradecahydro-1H-picene-3,8-diol
 |  
		| 5315134 | (3R,6aR,8S,8aS,12S,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradec ahydro-1H-picene-3,8-diol
 |  
 | internal high similarity DBLink  | Rows returned: 9 | 1 2 Next >> | 
 
 | active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 |  | 
 
 |