Compound Information | SONAR Target prediction | Name: | UVAOL | Unique Identifier: | SPE01504073 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 392.32 g/mol | X log p: | 2.292 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | Class: | triterpene | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) | Therapeutics: | antineoplastic |
Species: |
4932 |
Condition: |
SET2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7341±0.000565685 |
Normalized OD Score: sc h |
1.0230±0.00495456 |
Z-Score: |
1.3484±0.28514 |
p-Value: |
0.186315 |
Z-Factor: |
-2.2462 |
Fitness Defect: |
1.6803 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2007-11-15 YYYY-MM-DD | Plate CH Control (+): | 0.041175±0.00048 | Plate DMSO Control (-): | 0.711625±0.01758 | Plate Z-Factor: | 0.9334 |
| png ps pdf |
578224 |
1-ethyl-5,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-ol |
579336 |
4-(2,6,6-trimethyl-1-cyclohexenyl)butan-2-ol |
579719 |
3-(2,6,6-trimethyl-1-cyclohexenyl)propan-1-ol |
589260 |
n/a |
608886 |
8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropic en-3-ol |
620381 |
17-(5-hydroxypentan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phena nthren-12-ol |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|