Compound Information | SONAR Target prediction | Name: | UVAOL | Unique Identifier: | SPE01504073 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 392.32 g/mol | X log p: | 2.292 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | Class: | triterpene | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) | Therapeutics: | antineoplastic |
Species: |
4932 |
Condition: |
KGD1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7147±0.00176777 |
Normalized OD Score: sc h |
1.0292±0.0097882 |
Z-Score: |
1.7097±0.549777 |
p-Value: |
0.11119 |
Z-Factor: |
-4.47422 |
Fitness Defect: |
2.1965 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2007-09-11 YYYY-MM-DD | Plate CH Control (+): | 0.039400000000000004±0.00035 | Plate DMSO Control (-): | 0.6783±0.03949 | Plate Z-Factor: | 0.8045 |
| png ps pdf |
182053 |
(3S,4aS,6aR,6bS,8R,8aS,11R,12S,12aR,14aS,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11, 12,12a,14,14a-tetradecahydro-1H-picene-3,8-diol |
227829 |
2-[(3S,5R,8S)-3,8-dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-ol |
235956 |
4-(2-methyl-5-propan-2-yl-1-cyclopentenyl)butan-2-ol |
244185 |
1-(1-cyclopent-2-enyl)-2-methyl-propan-2-ol |
275618 |
n/a |
287687 |
6,8a-dimethyl-3-propan-2-yl-1,2,3,4,5,8-hexahydroazulen-3a-ol |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|