| Compound Information | SONAR Target prediction | | Name: | UVAOL | | Unique Identifier: | SPE01504073 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 392.32 g/mol | | X log p: | 2.292 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | | Class: | triterpene | | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex
latifolia | | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395
(1967) | | Therapeutics: | antineoplastic |
| Species: |
4932 |
| Condition: |
REF2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3560±0.0033234 |
| Normalized OD Score: sc h |
0.9918±0.00159748 |
| Z-Score: |
-0.2471±0.0461331 |
| p-Value: |
0.80496 |
| Z-Factor: |
-20.3115 |
| Fitness Defect: |
0.217 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 11|G10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2008-08-27 YYYY-MM-DD | | Plate CH Control (+): | 0.0421±0.00057 | | Plate DMSO Control (-): | 0.3355±0.01565 | | Plate Z-Factor: | 0.8395 |
|  png
ps
pdf |
| 7099914 |
(3S,4aS,6aS,6bR,8aS,12aS,14aR,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,
9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
| 7099915 |
(3S,4aS,6aS,6bR,8aR,12aS,14aR,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,
9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
| 11075071 |
1-[(2E)-1-cyclododec-2-enyl]propan-2-ol |
| 16038886 |
2-[(1S)-2,6,6-trimethyl-1-cyclohex-2-enyl]ethanol |
| 16046277 |
(1S,7R)-4-methylbicyclo[5.4.0]undec-4-en-1-ol |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|
