Compound Information | SONAR Target prediction | Name: | UVAOL | Unique Identifier: | SPE01504073 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 392.32 g/mol | X log p: | 2.292 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | Class: | triterpene | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) | Therapeutics: | antineoplastic |
Species: |
4932 |
Condition: |
SEC22 |
Replicates: |
2 |
Raw OD Value: r im |
0.6220±0.000848528 |
Normalized OD Score: sc h |
1.0310±0.000368883 |
Z-Score: |
1.0764±0.0634645 |
p-Value: |
0.28224 |
Z-Factor: |
-3.89713 |
Fitness Defect: |
1.265 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-10-16 YYYY-MM-DD | Plate CH Control (+): | 0.039599999999999996±0.00065 | Plate DMSO Control (-): | 0.5978749999999999±0.05259 | Plate Z-Factor: | 0.6879 |
| png ps pdf |
7002552 |
(3R,5R,8R,9S,10R,13R,14S,17S)-17-[(2S,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12 ,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7002553 |
(3R,5S,8R,9S,10R,13R,14S,17S)-17-[(2S,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12 ,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7092819 |
(3S,5R,8R,9S,10R,13R,14S,17R)-17-[(2S,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12 ,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7092820 |
(3S,5S,8R,9S,10R,13R,14S,17R)-17-[(2S,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12 ,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7099912 |
(3S,4aS,6aS,6bS,8aS,12aS,14aR,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8, 9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
7099913 |
(3S,4aS,6aS,6bS,8aR,12aS,14aR,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8, 9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|