| Compound Information | SONAR Target prediction | | Name: | UVAOL | | Unique Identifier: | SPE01504073 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 392.32 g/mol | | X log p: | 2.292 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | | Class: | triterpene | | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia | | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) | | Therapeutics: | antineoplastic |
| Species: |
4932 |
| Condition: |
SEC22 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6220±0.000848528 |
| Normalized OD Score: sc h |
1.0310±0.000368883 |
| Z-Score: |
1.0764±0.0634645 |
| p-Value: |
0.28224 |
| Z-Factor: |
-3.89713 |
| Fitness Defect: |
1.265 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|D7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.70 Celcius | | Date: | 2007-10-16 YYYY-MM-DD | | Plate CH Control (+): | 0.039599999999999996±0.00065 | | Plate DMSO Control (-): | 0.5978749999999999±0.05259 | | Plate Z-Factor: | 0.6879 |
| png ps pdf |
| 6366326 |
1-[(E)-hex-3-enyl]cyclohexan-1-ol |
| 6427131 |
2-[(3R,3aR,5R,8aS)-3,8-dimethyl-1,2,3,3a,4,5,6,8a-octahydroazulen-5-yl]propan-2-ol |
| 6428429 |
2-[(2S,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
| 6430754 |
2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
| 6431145 |
n/a |
| 6432005 |
2-[(2R,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|