Compound Information | SONAR Target prediction | Name: | UVAOL | Unique Identifier: | SPE01504073 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 392.32 g/mol | X log p: | 2.292 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | Class: | triterpene | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) | Therapeutics: | antineoplastic |
Species: |
4932 |
Condition: |
RPN1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6685±0.00756604 |
Normalized OD Score: sc h |
1.0029±0.0162759 |
Z-Score: |
0.1331±0.820209 |
p-Value: |
0.565384 |
Z-Factor: |
-45.481 |
Fitness Defect: |
0.5703 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 11|G10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.10 Celcius | Date: | 2008-05-28 YYYY-MM-DD | Plate CH Control (+): | 0.040499999999999994±0.00201 | Plate DMSO Control (-): | 0.6412±0.02046 | Plate Z-Factor: | 0.8949 |
| png ps pdf |
6366326 |
1-[(E)-hex-3-enyl]cyclohexan-1-ol |
6427131 |
2-[(3R,3aR,5R,8aS)-3,8-dimethyl-1,2,3,3a,4,5,6,8a-octahydroazulen-5-yl]propan-2-ol |
6428429 |
2-[(2S,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
6430754 |
2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
6431145 |
n/a |
6432005 |
2-[(2R,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|