Compound Information | SONAR Target prediction | Name: | UVAOL | Unique Identifier: | SPE01504073 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 392.32 g/mol | X log p: | 2.292 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | Class: | triterpene | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) | Therapeutics: | antineoplastic |
Species: |
4932 |
Condition: |
RIC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4557±0.0154149 |
Normalized OD Score: sc h |
1.0780±0.0512423 |
Z-Score: |
0.9029±0.458911 |
p-Value: |
0.39135 |
Z-Factor: |
-2.05134 |
Fitness Defect: |
0.9382 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2006-03-17 YYYY-MM-DD | Plate CH Control (+): | 0.03955±0.00182 | Plate DMSO Control (-): | 0.418075±0.01455 | Plate Z-Factor: | 0.8288 |
| png ps pdf |
5367324 |
(4E)-cyclonon-4-en-1-ol |
5367618 |
n/a |
5371070 |
3-methyl-2-[(E)-pent-2-enyl]cyclopentan-1-ol |
5377498 |
10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclo penta[a]phenanthren-16-ol |
5377524 |
10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclo penta[a]phenanthren-16-ol |
5461815 |
5-(1-cyclohex-2-enylmethyl)nonan-5-ol |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|