| Compound Information | SONAR Target prediction | | Name: | UVAOL | | Unique Identifier: | SPE01504073 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 392.32 g/mol | | X log p: | 2.292 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C | | Class: | triterpene | | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex
latifolia | | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395
(1967) | | Therapeutics: | antineoplastic |
| Species: |
4932 |
| Condition: |
pdr_yCG196 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7265±0.0106066 |
| Normalized OD Score: sc h |
0.9893±0.00164654 |
| Z-Score: |
-0.3594±0.0577943 |
| p-Value: |
0.719554 |
| Z-Factor: |
-116.436 |
| Fitness Defect: |
0.3291 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 19|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09925±0.00547 | | Plate DMSO Control (-): | 0.9100000000000001±0.02790 | | Plate Z-Factor: | 0.8705 |
|  png
ps
pdf |
| 5367324 |
(4E)-cyclonon-4-en-1-ol |
| 5367618 |
n/a |
| 5371070 |
3-methyl-2-[(E)-pent-2-enyl]cyclopentan-1-ol |
| 5377498 |
10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclo
penta[a]phenanthren-16-ol |
| 5377524 |
10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclo
penta[a]phenanthren-16-ol |
| 5461815 |
5-(1-cyclohex-2-enylmethyl)nonan-5-ol |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|
