| Compound Information | SONAR Target prediction |  | Name: | UVAOL |  | Unique Identifier: | SPE01504073  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 392.32 g/mol |  | X log p: | 2.292  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |  | Class: | triterpene |  | Source: | Arctostaphylos spp, Leucothoe keiskei, Crataegus cuneata, Osmanthus fragrans, Ilex latifolia |  | Reference: | Bull Chem Soc Jpn 39:2313 (1966); J Pharm Sci 55:1378 (1966); Phytochemistry 6:1395 (1967) |  | Therapeutics: | antineoplastic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MDH1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8232±0.035921 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0434±0.0243109 | 
	 
	
		| Z-Score: | 
		2.4105±1.10943 | 
	 
	
		| p-Value: | 
		0.0526718 | 
	 
	
		| Z-Factor: | 
		-3.72614 | 
	 
	
		| Fitness Defect: | 
		2.9437 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 8|D7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.60 Celcius |  | Date: | 2007-08-07 YYYY-MM-DD |  | Plate CH Control (+): | 0.04015±0.00054 |  | Plate DMSO Control (-): | 0.773725±0.04428 |  | Plate Z-Factor: | 0.8064 |  
  |  png ps pdf |  
 
 
	
		| 72607 | 
		2-[(3R,5S,8R)-3,8-dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-ol | 
	 
	
		| 85666 | 
		2-methyl-3-(4-propan-2-yl-1-cyclohexenyl)propan-1-ol | 
	 
	
		| 92802 | 
		(3S,4aS,6aR,6bS,8aS,11R,12S,12aR,14aS,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5, 6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-ol | 
	 
	
		| 94137 | 
		n/a | 
	 
	
		| 101679 | 
		(3R)-6,8a-dimethyl-3-propan-2-yl-1,2,3,4,5,8-hexahydroazulen-3a-ol | 
	 
	
		| 101761 | 
		(3S,4aS,6aR,6bS,8aS,12aR,14aS,14bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8, 9,10,12,12a,14,14a-tetradecahydropicen-3-ol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 9 | 1 2 Next >>  |   
 |  active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 |  |   
 
 |