| Compound Information | SONAR Target prediction | | Name: | PHYSCION | | Unique Identifier: | SPE01504070 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 272.168 g/mol | | X log p: | 8.14 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | COc1cc(O)c2c(=O)c3c(O)cc(C)cc3c(=O)c2c1 | | Class: | anthraquinone | | Source: | Xanthoria lichens, Rumex spp and various Aspergillus spp. | | Reference: | Helv Chim Acta 8: 140 (1925); Pharmacology 14: 1 (1976) | | Therapeutics: | antibacterial, cathartic |
| Species: |
4932 |
| Condition: |
RAD52 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4909±0.0180312 |
| Normalized OD Score: sc h |
0.8118±0.0103843 |
| Z-Score: |
-7.9297±0.526221 |
| p-Value: |
0.000000000000020577 |
| Z-Factor: |
-4.56556 |
| Fitness Defect: |
31.5146 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|D2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.80 Celcius | | Date: | 2007-10-26 YYYY-MM-DD | | Plate CH Control (+): | 0.041475±0.00078 | | Plate DMSO Control (-): | 0.6027±0.12919 | | Plate Z-Factor: | 0.3417 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 10639 |
1,8-dihydroxy-6-methoxy-3-methyl-anthracene-9,10-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|
