Compound Information | SONAR Target prediction | Name: | PHYSCION | Unique Identifier: | SPE01504070 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 272.168 g/mol | X log p: | 8.14 (online calculus) | Lipinksi Failures | 1 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | COc1cc(O)c2c(=O)c3c(O)cc(C)cc3c(=O)c2c1 | Class: | anthraquinone | Source: | Xanthoria lichens, Rumex spp and various Aspergillus spp. | Reference: | Helv Chim Acta 8: 140 (1925); Pharmacology 14: 1 (1976) | Therapeutics: | antibacterial, cathartic |
Species: |
4932 |
Condition: |
VID30 |
Replicates: |
2 |
Raw OD Value: r im |
0.6584±0.000989949 |
Normalized OD Score: sc h |
1.0011±0.000333183 |
Z-Score: |
0.0445±0.0196064 |
p-Value: |
0.964548 |
Z-Factor: |
-71.2616 |
Fitness Defect: |
0.0361 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 16|E7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2007-12-05 YYYY-MM-DD | Plate CH Control (+): | 0.041025±0.00045 | Plate DMSO Control (-): | 0.641475±0.01799 | Plate Z-Factor: | 0.9089 |
| png ps pdf |
DBLink | Rows returned: 1 | |
10639 |
1,8-dihydroxy-6-methoxy-3-methyl-anthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|