Compound Information | SONAR Target prediction | Name: | PHYSCION | Unique Identifier: | SPE01504070 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 272.168 g/mol | X log p: | 8.14 (online calculus) | Lipinksi Failures | 1 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | COc1cc(O)c2c(=O)c3c(O)cc(C)cc3c(=O)c2c1 | Class: | anthraquinone | Source: | Xanthoria lichens, Rumex spp and various Aspergillus spp. | Reference: | Helv Chim Acta 8: 140 (1925); Pharmacology 14: 1 (1976) | Therapeutics: | antibacterial, cathartic |
Species: |
4932 |
Condition: |
PPH21 |
Replicates: |
2 |
Raw OD Value: r im |
0.7960±0.0146371 |
Normalized OD Score: sc h |
1.0028±0.00586175 |
Z-Score: |
0.1022±0.211765 |
p-Value: |
0.881586 |
Z-Factor: |
-9.65047 |
Fitness Defect: |
0.126 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|D2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2006-05-16 YYYY-MM-DD | Plate CH Control (+): | 0.038974999999999996±0.00208 | Plate DMSO Control (-): | 0.791175±0.01646 | Plate Z-Factor: | 0.9286 |
| png ps pdf |
DBLink | Rows returned: 1 | |
10639 |
1,8-dihydroxy-6-methoxy-3-methyl-anthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|