| Compound Information | SONAR Target prediction | | Name: | PHYSCION | | Unique Identifier: | SPE01504070 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 272.168 g/mol | | X log p: | 8.14 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | COc1cc(O)c2c(=O)c3c(O)cc(C)cc3c(=O)c2c1 | | Class: | anthraquinone | | Source: | Xanthoria lichens, Rumex spp and various Aspergillus spp. | | Reference: | Helv Chim Acta 8: 140 (1925); Pharmacology 14: 1 (1976) | | Therapeutics: | antibacterial, cathartic |
| Species: |
4932 |
| Condition: |
pdr_yCG196 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7505±0.00919239 |
| Normalized OD Score: sc h |
1.0052±0.00761871 |
| Z-Score: |
0.1731±0.253488 |
| p-Value: |
0.859838 |
| Z-Factor: |
-6.59661 |
| Fitness Defect: |
0.151 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 19|G2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09925±0.00547 | | Plate DMSO Control (-): | 0.9100000000000001±0.02790 | | Plate Z-Factor: | 0.8705 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 10639 |
1,8-dihydroxy-6-methoxy-3-methyl-anthracene-9,10-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|
