Compound Information | SONAR Target prediction | Name: | FRAXETIN | Unique Identifier: | SPE01504069 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H8O5 | Molecular Weight: | 200.104 g/mol | X log p: | 7.161 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | COc1cc2C=CC(=O)Oc2c(O)c1O | Source: | ex Fraxinus, Peltogyne and Hydrangea spp | Reference: | Ber 62: 120 (1929) |
Species: |
4932 |
Condition: |
KGD1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7093±0.00912168 |
Normalized OD Score: sc h |
1.0019±0.0117868 |
Z-Score: |
0.1183±0.693945 |
p-Value: |
0.626066 |
Z-Factor: |
-15.5148 |
Fitness Defect: |
0.4683 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|A7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2007-09-11 YYYY-MM-DD | Plate CH Control (+): | 0.039925±0.00063 | Plate DMSO Control (-): | 0.697775±0.05217 | Plate Z-Factor: | 0.7691 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5273569 |
7,8-dihydroxy-6-methoxy-chromen-2-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 2974 | Additional Members: 2 | Rows returned: 0 | |
|