| Compound Information | SONAR Target prediction |  | Name: | DIOSMETIN |  | Unique Identifier: | SPE01504068  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C16H12O6 |  | Molecular Weight: | 288.168 g/mol |  | X log p: | 13.032  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | COc1ccc(cc1O)C1Oc2cc(O)cc(O)c2C(=O)C=1 |  | Source: | ex Valeriana, Digitalis spp |  | Reference: | J Indian Chem Soc 31: 565 (1954) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		TEP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6309±0.0152028 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9883±0.00159299 | 
	 
	
		| Z-Score: | 
		-0.3128±0.0614853 | 
	 
	
		| p-Value: | 
		0.754684 | 
	 
	
		| Z-Factor: | 
		-5.39073 | 
	 
	
		| Fitness Defect: | 
		0.2815 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 23|C5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.40 Celcius |  | Date: | 2005-12-23 YYYY-MM-DD |  | Plate CH Control (+): | 0.03905±0.00120 |  | Plate DMSO Control (-): | 0.587075±0.02270 |  | Plate Z-Factor: | 0.8660 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 5281612 | 
		5,7-dihydroxy-2-(3-hydroxy-4-methoxy-phenyl)chromen-4-one | 
	 
	
		| 5491353 | 
		2-(3,5-dihydroxy-4-methoxy-phenyl)-5,7-dihydroxy-chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 18 | 1 2 3 Next >>  |   
 |  active | Cluster 13276 | Additional Members: 6 | Rows returned: 1 |  |   
 
 |