| Compound Information | SONAR Target prediction | | Name: | STIGMASTEROL | | Unique Identifier: | SPE01504051 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 364.31 g/mol | | X log p: | 7.445 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CCC(C=CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C | | Class: | sterol | | Source: | soya and calabar beans; widely distributed in plant oils | | Generic_name: | CHOLESTEROL | | Chemical_iupac_name: | CHOLESTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C00187 | | Drugbank_id: | EXPT00945 | | Logp: | 7.445 | | Cas_registry_number: | 57-88-5 | | Drug_category: | Nuclear Receptor Ror-Alpha inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
BY4741-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9270±0.00388909 |
| Normalized OD Score: sc h |
0.9932±0.000727325 |
| Z-Score: |
0.0311±0.027678 |
| p-Value: |
0.975226 |
| Z-Factor: |
-12.583 |
| Fitness Defect: |
0.0251 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 21|D9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2012-05-28 YYYY-MM-DD | | Plate CH Control (+): | 0.09699999999999999±0.00126 | | Plate DMSO Control (-): | 0.9194999999999999±0.01942 | | Plate Z-Factor: | 0.9246 |
| png ps pdf |
| 7052687 |
(3R,5S,8R,9S,10R,17R)-17-(1-hydroxyethyl)-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclo penta[a]phenanthren-3-ol |
| 7052688 |
(3R,5S,8S,9R,10R,17R)-17-(1-hydroxyethyl)-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclo penta[a]phenanthren-3-ol |
| 7052689 |
(3R,5S,8S,9S,10R,17R)-17-(1-hydroxyethyl)-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclo penta[a]phenanthren-3-ol |
| 7052840 |
(3S,8R,9R,10S,13R,14S,17R)-10,13-dimethyl-17-prop-2-enyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthrene-3,17-diol |
| 7052841 |
(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-prop-2-enyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthrene-3,17-diol |
| 7052842 |
(3R,8R,9R,10S,13R,14S,17R)-10,13-dimethyl-17-prop-2-enyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthrene-3,17-diol |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 | |
|