Compound Information | SONAR Target prediction | Name: | STIGMASTEROL | Unique Identifier: | SPE01504051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.31 g/mol | X log p: | 7.445 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CCC(C=CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C | Class: | sterol | Source: | soya and calabar beans; widely distributed in plant oils | Generic_name: | CHOLESTEROL | Chemical_iupac_name: | CHOLESTEROL | Drug_type: | Experimental | Kegg_compound_id: | C00187 | Drugbank_id: | EXPT00945 | Logp: | 7.445 | Cas_registry_number: | 57-88-5 | Drug_category: | Nuclear Receptor Ror-Alpha inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
CIN2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8136±0.00318198 |
Normalized OD Score: sc h |
1.0012±0.00282865 |
Z-Score: |
0.0678±0.158246 |
p-Value: |
0.91111 |
Z-Factor: |
-90.4833 |
Fitness Defect: |
0.0931 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|G11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.40 Celcius | Date: | 2006-02-14 YYYY-MM-DD | Plate CH Control (+): | 0.03949999999999999±0.00126 | Plate DMSO Control (-): | 0.7910250000000001±0.02006 | Plate Z-Factor: | 0.8856 |
| png ps pdf |
5364746 |
17-[(E)-hex-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanth ren-3-ol |
5365965 |
17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-3-ol |
5365969 |
10,13-dimethyl-17-[(E)-5,6,7-trimethyloct-4-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-ol |
5366051 |
10,13-dimethyl-17-[(E)-5,5,6-trimethylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-ol |
5368392 |
(17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
5377403 |
10,13-dimethyl-17-[(E)-5-methylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a ]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 | |
|