Compound Information | SONAR Target prediction | Name: | STIGMASTEROL | Unique Identifier: | SPE01504051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.31 g/mol | X log p: | 7.445 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CCC(C=CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C | Class: | sterol | Source: | soya and calabar beans; widely distributed in plant oils | Generic_name: | CHOLESTEROL | Chemical_iupac_name: | CHOLESTEROL | Drug_type: | Experimental | Kegg_compound_id: | C00187 | Drugbank_id: | EXPT00945 | Logp: | 7.445 | Cas_registry_number: | 57-88-5 | Drug_category: | Nuclear Receptor Ror-Alpha inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SEC22 |
Replicates: |
2 |
Raw OD Value: r im |
0.6518±0.0304763 |
Normalized OD Score: sc h |
0.9872±0.0155672 |
Z-Score: |
-0.4557±0.561575 |
p-Value: |
0.67355 |
Z-Factor: |
-150.787 |
Fitness Defect: |
0.3952 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|G11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2007-10-16 YYYY-MM-DD | Plate CH Control (+): | 0.039625±0.00105 | Plate DMSO Control (-): | 0.657025±0.02787 | Plate Z-Factor: | 0.8540 |
| png ps pdf |
5315647 |
4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,13,14,14a-tetradecahydropicene-3,9-diol |
5315842 |
(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent a[a]phenanthren-3-ol |
5316716 |
(3S,10R,13R)-17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-ol |
5317408 |
(3S,10R,13R,17R)-10,13-dimethyl-17-[(E)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodec ahydro-1H-cyclopenta[a]phenanthren-3-ol |
5317737 |
(6bR,8aR,12aR,14aR)-4,4,6a,6b,8a,11,11,14a-octamethyl-1,2,3,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydr opicen-3-ol |
5317739 |
(3S,6bR,8aR,12aR,14aR)-4,4,6a,6b,8a,11,11,14a-octamethyl-1,2,3,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecah ydropicen-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 | |
|