| Compound Information | SONAR Target prediction | | Name: | STIGMASTEROL | | Unique Identifier: | SPE01504051 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 364.31 g/mol | | X log p: | 7.445 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CCC(C=CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C | | Class: | sterol | | Source: | soya and calabar beans; widely distributed in plant oils | | Generic_name: | CHOLESTEROL | | Chemical_iupac_name: | CHOLESTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C00187 | | Drugbank_id: | EXPT00945 | | Logp: | 7.445 | | Cas_registry_number: | 57-88-5 | | Drug_category: | Nuclear Receptor Ror-Alpha inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
PRE9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6791±0.0347897 |
| Normalized OD Score: sc h |
0.9886±0.00202613 |
| Z-Score: |
-0.4322±0.0824506 |
| p-Value: |
0.66614 |
| Z-Factor: |
-27.1784 |
| Fitness Defect: |
0.4063 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|G11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.30 Celcius | | Date: | 2007-10-04 YYYY-MM-DD | | Plate CH Control (+): | 0.039349999999999996±0.00390 | | Plate DMSO Control (-): | 0.6803250000000001±0.03095 | | Plate Z-Factor: | 0.8509 |
|  png
ps
pdf |
| 634972 |
17-(5-ethyl-6-methyl-heptan-2-yl)-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclope
nta[a]phenanthrene-3,11-diol |
| 636741 |
(3S,8R,9R,10S,13R,14S,17R)-17-[(2R,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14
,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 638019 |
(3S,8R,9R,10R,13S,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-do
decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 656449 |
14-(hydroxymethyl)-4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-
1H-cyclopenta[a]phenanthren-3-ol |
| 1547492 |
(3R,8S,9R,10S,13S,14S,17R)-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phena
nthrene-3,17-diol |
| 1806551 |
(3R,8S,9R,10S,13S,14R,17R)-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phena
nthrene-3,17-diol |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 | |
|
