Compound Information | SONAR Target prediction | Name: | STIGMASTEROL | Unique Identifier: | SPE01504051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.31 g/mol | X log p: | 7.445 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CCC(C=CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C | Class: | sterol | Source: | soya and calabar beans; widely distributed in plant oils | Generic_name: | CHOLESTEROL | Chemical_iupac_name: | CHOLESTEROL | Drug_type: | Experimental | Kegg_compound_id: | C00187 | Drugbank_id: | EXPT00945 | Logp: | 7.445 | Cas_registry_number: | 57-88-5 | Drug_category: | Nuclear Receptor Ror-Alpha inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
PEP5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6816±0.0105359 |
Normalized OD Score: sc h |
0.9899±0.00412104 |
Z-Score: |
-0.5412±0.234841 |
p-Value: |
0.593508 |
Z-Factor: |
-10.8719 |
Fitness Defect: |
0.5217 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 23|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2008-08-14 YYYY-MM-DD | Plate CH Control (+): | 0.048775±0.00204 | Plate DMSO Control (-): | 0.67435±0.01657 | Plate Z-Factor: | 0.9084 |
| png ps pdf |
634972 |
17-(5-ethyl-6-methyl-heptan-2-yl)-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclope nta[a]phenanthrene-3,11-diol |
636741 |
(3S,8R,9R,10S,13R,14S,17R)-17-[(2R,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14 ,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
638019 |
(3S,8R,9R,10R,13S,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-do decahydro-1H-cyclopenta[a]phenanthren-3-ol |
656449 |
14-(hydroxymethyl)-4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro- 1H-cyclopenta[a]phenanthren-3-ol |
1547492 |
(3R,8S,9R,10S,13S,14S,17R)-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phena nthrene-3,17-diol |
1806551 |
(3R,8S,9R,10S,13S,14R,17R)-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phena nthrene-3,17-diol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 | |
|