| Compound Information | SONAR Target prediction | | Name: | STIGMASTEROL | | Unique Identifier: | SPE01504051 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 364.31 g/mol | | X log p: | 7.445 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CCC(C=CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C | | Class: | sterol | | Source: | soya and calabar beans; widely distributed in plant oils | | Generic_name: | CHOLESTEROL | | Chemical_iupac_name: | CHOLESTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C00187 | | Drugbank_id: | EXPT00945 | | Logp: | 7.445 | | Cas_registry_number: | 57-88-5 | | Drug_category: | Nuclear Receptor Ror-Alpha inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
PFK2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4602±0.00275772 |
| Normalized OD Score: sc h |
0.9809±0.00363839 |
| Z-Score: |
-0.6168±0.130298 |
| p-Value: |
0.539104 |
| Z-Factor: |
-10.0988 |
| Fitness Defect: |
0.6178 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 23|H10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2008-05-10 YYYY-MM-DD | | Plate CH Control (+): | 0.04045±0.00037 | | Plate DMSO Control (-): | 0.46262500000000006±0.03006 | | Plate Z-Factor: | 0.7601 |
|  png
ps
pdf |
| 595345 |
n/a |
| 596452 |
n/a |
| 623160 |
10,13-dimethyl-17-[1-[2-(3-methylbut-1-en-2-yl)cyclopropyl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy
dro-1H-cyclopenta[a]phenanthren-3-ol |
| 623201 |
10,13-dimethyl-17-[1-(2-methyl-3-propan-2-yl-cyclopropyl)propan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dode
cahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 623272 |
10,13-dimethyl-17-(5-methylhex-5-en-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phen
anthren-3-ol |
| 623306 |
10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 | |
|
