| Compound Information | SONAR Target prediction |
| Name: | TRIACETYLRESVERATROL |
| Unique Identifier: | SPE01504041 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 336.21 g/mol |
| X log p: | 18.831 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 78.9 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 8 |
| Canonical Smiles: | CC(=O)Oc1ccc(cc1)C=Cc1cc(OC(C)=O)cc(OC(C)=O)c1 |
| Class: | stilbene |
| Source: | Kirkpatrickia variolosa (sponge) |
| Reference: | Aust J Chem 24:2427 (1971); Phytochemistry 32:1083 (1993); J Nat Prod 58:1958 (1995) |
| Found: 204 nonactive | as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [204] |
| Species: | 4932 |
| Condition: | APC9 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7129±0.00784888 |
| Normalized OD Score: sc h | 1.0308±0.00903833 |
| Z-Score: | 1.6680±0.465868 |
| p-Value: | 0.113234 |
| Z-Factor: | -2.32807 |
| Fitness Defect: | 2.1783 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 2 |
| 3935161 | [4-[2-(3,5-diacetyloxyphenyl)ethenyl]phenyl] acetate |
| 5962587 | [3-acetyloxy-5-[(E)-2-(4-acetyloxyphenyl)ethenyl]phenyl] acetate |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 14842 | Additional Members: 6 | Rows returned: 1 |
| SPE00240740 | 0 |
Service provided by the
Mike Tyers Laboratory