| Compound Information | SONAR Target prediction |
| Name: | CYTISINE |
| Unique Identifier: | SPE01504027 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 176.131 g/mol |
| X log p: | 5.941 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 20.31 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | O=C1C=CC=C2C3CNCC(C3)CN12 |
| Class: | alkaloid |
| Source: | Thermopsis lanceolata |
| Reference: | J Chem Soc 1932: 2778; Martindale 28th Ed, 1700 (1982) |
| Therapeutics: | antiinflammatory, respiratory stimulant |
| Found: 205 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [205] |
| Species: | 4932 |
| Condition: | APC9 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6838±0.00643467 |
| Normalized OD Score: sc h | 0.9845±0.00647671 |
| Z-Score: | -0.8435±0.364572 |
| p-Value: | 0.414428 |
| Z-Factor: | -7.50587 |
| Fitness Defect: | 0.8809 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 39 | 1 2 3 4 5 6 7 Next >> |
| 10235 |
| 10245 |
| 22124 |
| 22125 |
| 22406 |
| 22407 |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01504023 | 0.9440 |
| active | Cluster 16980 | Additional Members: 3 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory