| Compound Information | SONAR Target prediction |  | Name: | alpha-MANGOSTIN |  | Unique Identifier: | SPE01504015  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 384.253 g/mol |  | X log p: | 9.508  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COc1c(O)cc2Oc3cc(O)c(CC=C(C)C)c(O)c3C(=O)c2c1CC=C(C)C |  | Class: | xanthone |  | Source: | Garcinia mangostana, Hydnocarpus octandra, H venenata |  | Reference: | JACS 80:1691 (1958); Aust J Chem 23:2539 (1970); Tetrahedron 27:3919 (1971); Phytochemistry 12:232 (1973) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ARC18 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6822±0.000636396 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9823±0.0030465 | 
	 
	
		| Z-Score: | 
		-0.8005±0.153189 | 
	 
	
		| p-Value: | 
		0.42616 | 
	 
	
		| Z-Factor: | 
		-3.43078 | 
	 
	
		| Fitness Defect: | 
		0.8529 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 15|D8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.30 Celcius |  | Date: | 2008-02-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.042249999999999996±0.00153 |  | Plate DMSO Control (-): | 0.683425±0.01254 |  | Plate Z-Factor: | 0.9362 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 5281650 | 
		1,3,6-trihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 18131 | Additional Members: 2 | Rows returned: 1 |  |   
 
 |