| 
 | Compound Information | SONAR Target prediction |  | Name: | BAICALEIN |  | Unique Identifier: | SPE01504002 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 260.158 g/mol |  | X log p: | 15.555  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2c(O)c1O)c1ccccc1 |  | Class: | flavone |  | Source: | Scutellaria baicalensis |  | Reference: | Gazz Chim acta 49 (II): 47 (1919); Acta Phytochim 1: 109 (1923); Phytochemistry 10: 3298 (1971)
 |  | Therapeutics: | antiviral (HIV) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | FKS1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.2381±0.0066468 |  
		| Normalized OD Score: sc h | 0.3546±0.00766372 |  
		| Z-Score: | -12.5634±1.31408 |  
		| p-Value: | 1.38118e-31 |  
		| Z-Factor: | 0.859489 |  
		| Fitness Defect: | 71.0572 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 1|E6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.50 Celcius |  | Date: | 2008-06-04 YYYY-MM-DD |  | Plate CH Control (+): | 0.040675±0.00043 |  | Plate DMSO Control (-): | 0.6364000000000001±0.00945 |  | Plate Z-Factor: | 0.9446 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 2 |  | 
 
	
		| 5281605 | 5,6,7-trihydroxy-2-phenyl-chromen-4-one |  
		| 5702782 | 5,6,7-trihydroxy-2-phenyl-chromen-4-one hydrate |  
 | internal high similarity DBLink  | Rows returned: 16 | 1 2 3 Next >> | 
 
 | active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 |  | 
 
 |