Compound Information | SONAR Target prediction | Name: | BAICALEIN | Unique Identifier: | SPE01504002 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 260.158 g/mol | X log p: | 15.555 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2c(O)c1O)c1ccccc1 | Class: | flavone | Source: | Scutellaria baicalensis | Reference: | Gazz Chim acta 49 (II): 47 (1919); Acta Phytochim 1: 109 (1923); Phytochemistry 10: 3298 (1971) | Therapeutics: | antiviral (HIV) |
Species: |
4932 |
Condition: |
CLN2 |
Replicates: |
2 |
Raw OD Value: r im |
0.4950±0.0250316 |
Normalized OD Score: sc h |
0.7789±0.0327779 |
Z-Score: |
-6.1155±1.7784 |
p-Value: |
0.000000593052 |
Z-Factor: |
-5.10434 |
Fitness Defect: |
14.338 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 19|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.086±0.01075 | Plate DMSO Control (-): | 0.8600000000000001±0.04472 | Plate Z-Factor: | 0.7953 |
| png ps pdf |
DBLink | Rows returned: 2 | |
5281605 |
5,6,7-trihydroxy-2-phenyl-chromen-4-one |
5702782 |
5,6,7-trihydroxy-2-phenyl-chromen-4-one hydrate |
internal high similarity DBLink | Rows returned: 16 | << Back 1 2 3 |
active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 | |
|