| Compound Information | SONAR Target prediction |  | Name: | BAICALEIN |  | Unique Identifier: | SPE01504002  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 260.158 g/mol |  | X log p: | 15.555  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2c(O)c1O)c1ccccc1 |  | Class: | flavone |  | Source: | Scutellaria baicalensis |  | Reference: | Gazz Chim acta 49 (II): 47 (1919); Acta Phytochim 1: 109 (1923); Phytochemistry 10: 3298 (1971) |  | Therapeutics: | antiviral (HIV) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MSO1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5293±0.0123037 | 
	 
	
		| Normalized OD Score: sc h | 
		0.7139±0.012766 | 
	 
	
		| Z-Score: | 
		-14.0683±1.1691 | 
	 
	
		| p-Value: | 
		2.52357e-40 | 
	 
	
		| Z-Factor: | 
		0.664022 | 
	 
	
		| Fitness Defect: | 
		91.1777 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 1|E6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.30 Celcius |  | Date: | 2008-02-27 YYYY-MM-DD |  | Plate CH Control (+): | 0.040999999999999995±0.00174 |  | Plate DMSO Control (-): | 0.701275±0.01329 |  | Plate Z-Factor: | 0.9238 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 5281605 | 
		5,6,7-trihydroxy-2-phenyl-chromen-4-one | 
	 
	
		| 5702782 | 
		5,6,7-trihydroxy-2-phenyl-chromen-4-one hydrate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 16 | 1 2 3 Next >>  |   
 |  active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 |  |   
 
 |