Compound Information | SONAR Target prediction |
Name: | N,N-DIMETHYLAMILORIDE |
Unique Identifier: | SPE01503999 |
MolClass: | Checkout models in ver1.5 and ver1.0 |
Molecular Formula: | C8Cl2H13N7O |
Molecular Weight: | 281.038 g/mol |
X log p: | -1.523 (online calculus) |
Lipinksi Failures | 0 |
TPSA | 45.03 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptors Count: | 8 |
Rotatable Bond Count: | 4 |
Canonical Smiles: | Cl.CN(C)c1nc(N)c(nc1Cl)C(=O)NC(N)=N |
Reference: | J Pharmacol Exp Therap 256: 1094 (1991) |
Therapeutics: | inhibitor of Na+/H+ antiport |