| Compound Information | SONAR Target prediction | | Name: | LOVASTATIN | | Unique Identifier: | SPE01503977 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 368.254 g/mol | | X log p: | 6.185 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C12 | | Source: | Aspergillus spp; mevinolin | | Reference: | PNAS 77:3957 (1980); Int J Oncol 12:717 (1998) | | Therapeutics: | antihyperlipidemic, HMGCoA reductase inhibitor | | Generic_name: | Simvastatin | | Chemical_iupac_name: | [8-[2-(4-hydroxy-6-oxo-tetrahydropyran-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahyd ronaphthalen-1-yl]2,2-dimethylbutanoate | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA451363 | | Kegg_compound_id: | D00434 | | Drugbank_id: | APRD00104 | | Melting_point: | 135-138oC | | H2o_solubility: | 0.76 mg/L | | Logp: | 4.937 | | Cas_registry_number: | 79902-63-9 | | Drug_category: | Antilipemic Agents; Anticholesteremic Agents; HMG-CoA Reductase Inhibitors; ATC:C10AA01 | | Indication: | For the treatment of hypercholesterolemia. | | Pharmacology: | Simvastatin, the methylated form of lovastatin, is an oral antilipemic agent which inhibits HMG-CoA reductase. simvastatin is used in the treatment of primary hypercholesterolemia and is effective in reducing total and LDL-cholesterol as well as plasma triglycerides and apolipoprotein B. | | Mechanism_of_action: | The 6-membered lactone ring of simvastatin is hydrolyzed in vivo to generate mevinolinic acid, an active metabolite structurally similar to HMG-CoA (hydroxymethylglutaryl CoA). Once hydrolyzed, simvastatin competes with HMG-CoA for HMG-CoA reductase, a hepatic microsomal enzyme. Interference with the activity of this enzyme reduces the quantity of mevalonic acid, a precursor of cholesterol. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
CCR4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5962±0.00997021 |
| Normalized OD Score: sc h |
0.8198±0.0207622 |
| Z-Score: |
-7.6823±0.824709 |
| p-Value: |
0.00000000000062759 |
| Z-Factor: |
0.0324748 |
| Fitness Defect: |
28.0969 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 20|E9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.90 Celcius | | Date: | 2008-04-16 YYYY-MM-DD | | Plate CH Control (+): | 0.041850000000000005±0.00125 | | Plate DMSO Control (-): | 0.67705±0.02676 | | Plate Z-Factor: | 0.8657 |
| png ps pdf |
| 2854 |
[8-[2-(4-hydroxy-6-oxo-oxan-2-yl)ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| 3962 |
[8-[2-(4-hydroxy-6-oxo-oxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| 53232 |
[(1S,3R,7R,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronap hthalen-1-yl] (2S)-2-methylbutanoate |
| 54454 |
[(1S,3R,7R,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronap hthalen-1-yl] 2,2-dimethylbutanoate |
| 64715 |
[(1S,7R,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen -1-yl] (2S)-2-methylbutanoate |
| 129467 |
[8-[2-(4-hydroxy-6-oxo-oxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-hydroxybutanoate |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 2780 | Additional Members: 9 | Rows returned: 5 | |
|