| Compound Information | SONAR Target prediction | | Name: | RIBAVIRIN | | Unique Identifier: | SPE01503938 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 232.11 g/mol | | X log p: | 1.235 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 54.26 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 9 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | NC(=O)c1ncn(n1)C1OC(CO)C(O)C1O | | Source: | synthetic | | Therapeutics: | antiviral | | Generic_name: | Ribavirin | | Chemical_iupac_name: | 1-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1H-1,2,4-triazole-3-carboxam ide | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA451241 | | Drugbank_id: | APRD00081 | | Melting_point: | 174-176 oC | | H2o_solubility: | 142 mg/ml (max, at 25°C) | | Logp: | -2.645 | | Cas_registry_number: | 36791-04-5 | | Drug_category: | Antiviral Agents; ATC:J05AB04 | | Indication: | For the treatment of chronic hepatitis C and for respiratory syncytial virus (RSV). | | Pharmacology: | Ribavirin is an anti-viral drug active against a number of DNA and RNA viruses. It is a member of the nucleoside antimetabolite drugs that interfere with duplication of the viral genetic material. The drug inhibits the activity of the enzyme RNA dependent RNA polymerase, due to it-s resemblence to building blocks of the RNA molecules. The oral form is used in the treatment of hepatitis C, in combination with interferon drugs. The aerosol form is used to treat respiratory syncytial virus-related diseases in children. The primary serious adverse effect of ribavirin is hemolytic anemia, which may worsen preexisting cardiac disease. | | Mechanism_of_action: | Ribavirin is readily phosphorylated intracellularly by adenosine kinase to ribavirin mono-, di-, and triphosphate metabolites. Ribavirin triphosphate (RTP) is a potent competitive inhibitor of inosine monophosphate (IMP) dehydrogenase, viral RNA polymerase and messenger RNA (mRNA) guanylyltransferase (viral). Guanylyltranserase inhibition stops the capping of mRNA. These diverse effects result in a marked reduction of intracellular guanosine triphosphate (GTP) pools and inhibition of viral RNA and protein synthesis. Ribavirin is also incorporated into the viral genome causing lethal mutagenesis and a subsequent decrease in specific viral infectivity. | | Organisms_affected: | Hepatitis C virus, RSV and other RNA/DNA viruses |
| Species: |
4932 |
| Condition: |
RRP6 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6616±0.0123744 |
| Normalized OD Score: sc h |
0.9820±0.00284709 |
| Z-Score: |
-0.6599±0.0732591 |
| p-Value: |
0.509882 |
| Z-Factor: |
-6.2126 |
| Fitness Defect: |
0.6736 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 20|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.50 Celcius | | Date: | 2008-03-14 YYYY-MM-DD | | Plate CH Control (+): | 0.041325±0.00045 | | Plate DMSO Control (-): | 0.657625±0.01985 | | Plate Z-Factor: | 0.9028 |
| png ps pdf |
| 6603992 |
1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| 6604395 |
1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| 6713992 |
1-[(2R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| 7048773 |
1-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| 7048774 |
1-[(2R,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 4792 | Additional Members: 4 | Rows returned: 0 | |
|