| Compound Information | SONAR Target prediction | | Name: | PERPHENAZINE | | Unique Identifier: | SPE01503934 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 377.763 g/mol | | X log p: | 16.257 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.02 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc23)CC1 | | Source: | synthetic | | Therapeutics: | antipsychotic | | Generic_name: | Perphenazine | | Chemical_iupac_name: | 2-[4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA450882 | | Kegg_compound_id: | C07427 | | Drugbank_id: | APRD00429 | | Melting_point: | 97 oC | | H2o_solubility: | 28.3 mg/L | | Logp: | 4.176 | | Isoelectric_point: | 7.94 | | Cas_registry_number: | 58-39-9 | | Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C58399&Index=0&Type=Mass&Large=on | | Drug_category: | Antipsychotics; Phenothiazines; Dopamine Antagonists; ATC:N05AB03 | | Indication: | For use in the management of the manifestations of psychotic disorders and for the control of severe nausea and vomiting in adults. | | Pharmacology: | Perphenazine is a piperazinyl phenothiazine, acts on the central nervous system, and has a greater behavioral potency than other phenothiazine derivatives whose side chains do not contain a piperazine moiety. It is a member of a class of drugs called phenothiazines, which are dopamine D1/D2 receptor antagonists. Perphenazine is 10 to 15 times as potent as chlorpromazine; that means perphenazine is a highly potent antipsychotic. In equivalent doses it has approximately the same frequency and severity of early and late extrapypramidal side-effects compared to Haloperidol. | | Mechanism_of_action: | Binds to the dopamine D1 and dopamine D2 receptors and inhibits their activity. The mechanism of the anti-emetic effect is due predominantly to blockage of the dopamine D2 neurotransmitter receptors in the chemoreceptor trigger zone and vomiting centre. Perphenazine also binds the alpha andrenergic receptor. This receptor-s action is mediated by association with G proteins that activate a phosphatidylinositol-calcium second messenger system. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
DOC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5910±0.0119501 |
| Normalized OD Score: sc h |
1.0358±0.0127263 |
| Z-Score: |
1.2605±0.411168 |
| p-Value: |
0.226504 |
| Z-Factor: |
-2.449 |
| Fitness Defect: |
1.485 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 20|E5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2008-05-09 YYYY-MM-DD | | Plate CH Control (+): | 0.04235±0.00118 | | Plate DMSO Control (-): | 0.544925±0.02013 | | Plate Z-Factor: | 0.8868 |
| png ps pdf |
| DBLink | Rows returned: 6 | |
| 4748 |
2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol |
| 74835 |
2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol dihydrochloride |
| 168090 |
2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol hydrochloride |
| 213548 |
2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]-1,4-dimethyl-2,3,5,6-tetrahydropyrazin-1-yl]ethanol diiodide |
| 213549 |
2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]-1,4-dimethyl-2,3,5,6-tetrahydropyrazin-1-yl]ethanol |
| 4282573 |
2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]-2,3,5,6-tetrahydropyrazin-1-yl]ethanol |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17541 | Additional Members: 13 | Rows returned: 3 | |
|