| Compound Information | SONAR Target prediction |  | Name: | PERPHENAZINE |  | Unique Identifier: | SPE01503934  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 377.763 g/mol |  | X log p: | 16.257  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.02 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc23)CC1 |  | Source: | synthetic |  | Therapeutics: | antipsychotic |  | Generic_name: | Perphenazine |  | Chemical_iupac_name: | 2-[4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol |  | Drug_type: | Approved Drug |  | Pharmgkb_id: | PA450882 |  | Kegg_compound_id: | C07427 |  | Drugbank_id: | APRD00429 |  | Melting_point: | 97 oC |  | H2o_solubility: | 28.3 mg/L |  | Logp: | 4.176 |  | Isoelectric_point: | 7.94 |  | Cas_registry_number: | 58-39-9 |  | Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C58399&Index=0&Type=Mass&Large=on |  | Drug_category: | Antipsychotics; Phenothiazines; Dopamine Antagonists; ATC:N05AB03 |  | Indication: | For use in the management of the manifestations of psychotic disorders and for the control of severe nausea and vomiting in adults. |  | Pharmacology: | Perphenazine is a piperazinyl phenothiazine, acts on the central nervous system, and has a greater behavioral potency than other phenothiazine derivatives whose side chains do not contain a piperazine moiety. It is a member of a class of drugs called phenothiazines, which are dopamine D1/D2 receptor antagonists. Perphenazine is 10 to 15 times as potent as chlorpromazine; that means perphenazine is a highly potent antipsychotic. In equivalent doses it has approximately the same frequency and severity of early and late extrapypramidal side-effects compared to Haloperidol. |  | Mechanism_of_action: | Binds to the dopamine D1 and dopamine D2 receptors and inhibits their activity. The mechanism of the anti-emetic effect is due predominantly to blockage of the dopamine D2 neurotransmitter receptors in the chemoreceptor trigger zone and vomiting centre. Perphenazine also binds the alpha andrenergic receptor. This receptor-s action is mediated by association with G proteins that activate a phosphatidylinositol-calcium second messenger system. |  | Organisms_affected: | Humans and other mammals |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		DCC1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6554±0.00997021 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9941±0.00930644 | 
	 
	
		| Z-Score: | 
		-0.2702±0.420016 | 
	 
	
		| p-Value: | 
		0.774602 | 
	 
	
		| Z-Factor: | 
		-238.474 | 
	 
	
		| Fitness Defect: | 
		0.2554 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 20|E5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.50 Celcius |  | Date: | 2008-06-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.0401±0.00081 |  | Plate DMSO Control (-): | 0.6510499999999999±0.01374 |  | Plate Z-Factor: | 0.9287 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 6 |  |  
 
	
		| 4748 | 
		2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol | 
	 
	
		| 74835 | 
		2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol dihydrochloride | 
	 
	
		| 168090 | 
		2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol hydrochloride | 
	 
	
		| 213548 | 
		2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]-1,4-dimethyl-2,3,5,6-tetrahydropyrazin-1-yl]ethanol diiodide | 
	 
	
		| 213549 | 
		2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]-1,4-dimethyl-2,3,5,6-tetrahydropyrazin-1-yl]ethanol | 
	 
	
		| 4282573 | 
		2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]-2,3,5,6-tetrahydropyrazin-1-yl]ethanol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 17541 | Additional Members: 13 | Rows returned: 3 |  |   
 
 |