| Compound Information | SONAR Target prediction | | Name: | CYPROTERONE | | Unique Identifier: | SPE01503921 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C22ClH27O3 | | Molecular Weight: | 347.686 g/mol | | X log p: | 2.906 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(=O)C1(O)CCC2C3C=C(Cl)C4=CC(=O)C5CC5C4(C)C3CCC21C | | Therapeutics: | antiandrogen |
| Species: |
4932 |
| Condition: |
NBP2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7549±0.0126572 |
| Normalized OD Score: sc h |
1.0006±0.00552168 |
| Z-Score: |
0.0259±0.140414 |
| p-Value: |
0.920936 |
| Z-Factor: |
-12.2924 |
| Fitness Defect: |
0.0824 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 18|C2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.90 Celcius | | Date: | 2006-02-17 YYYY-MM-DD | | Plate CH Control (+): | 0.038475±0.00131 | | Plate DMSO Control (-): | 0.7414000000000001±0.02683 | | Plate Z-Factor: | 0.8666 |
| png ps pdf |
| 5284537 |
n/a |
| 5702275 |
n/a |
| 11726188 |
(8R,9S,10R,13S,17R)-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclo penta[a]phenanthren-3-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5652 | Additional Members: 7 | Rows returned: 2 | |
|