Compound Information | SONAR Target prediction | Name: | CYPROTERONE | Unique Identifier: | SPE01503921 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22ClH27O3 | Molecular Weight: | 347.686 g/mol | X log p: | 2.906 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(=O)C1(O)CCC2C3C=C(Cl)C4=CC(=O)C5CC5C4(C)C3CCC21C | Therapeutics: | antiandrogen |
Species: |
4932 |
Condition: |
DBP3 |
Replicates: |
2 |
Raw OD Value: r im |
0.7041±0.00940452 |
Normalized OD Score: sc h |
1.0015±0.00732265 |
Z-Score: |
0.0720±0.377116 |
p-Value: |
0.790262 |
Z-Factor: |
-16.545 |
Fitness Defect: |
0.2354 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 18|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-09-13 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00070 | Plate DMSO Control (-): | 0.695975±0.04874 | Plate Z-Factor: | 0.7309 |
| png ps pdf |
3015 |
n/a |
16065 |
(9S,14S,17R)-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a ]phenanthren-3-one |
16417 |
n/a |
21461 |
17-acetyl-6-chloro-17-hydroxy-10,13,16-trimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanth ren-3-one |
168905 |
(17R)-17-acetyl-6-chloro-17-hydroxy-13-methyl-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthre n-3-one |
5284533 |
(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-c yclopenta[a]phenanthren-3-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5652 | Additional Members: 7 | Rows returned: 2 | |
|