Compound Information | SONAR Target prediction | Name: | CLENBUTEROL HYDROCHLORIDE | Unique Identifier: | SPE01503917 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 294.499 g/mol | X log p: | 4.219 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 4 | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 | Source: | synthetic; NAB-365 | Therapeutics: | bronchodilator, beta2 adrenergic agonist |
Species: |
4932 |
Condition: |
ARX1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6653±0.00148492 |
Normalized OD Score: sc h |
0.9829±0.000183749 |
Z-Score: |
-0.8454±0.0625298 |
p-Value: |
0.398376 |
Z-Factor: |
-14.8079 |
Fitness Defect: |
0.9204 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 17|F10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2007-10-11 YYYY-MM-DD | Plate CH Control (+): | 0.04055±0.00060 | Plate DMSO Control (-): | 0.6805749999999999±0.02385 | Plate Z-Factor: | 0.8810 |
| png ps pdf |
2783 |
1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |
30849 |
[2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium chloride |
217246 |
1-(4-amino-3,5-dichloro-phenyl)-2-(propan-2-ylamino)ethanol |
688427 |
(1R)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |
688428 |
(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |
5231296 |
[2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
internal high similarity DBLink | Rows returned: 0 | |
|