Compound Information | SONAR Target prediction | Name: | CLENBUTEROL HYDROCHLORIDE | Unique Identifier: | SPE01503917 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 294.499 g/mol | X log p: | 4.219 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 4 | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 | Source: | synthetic; NAB-365 | Therapeutics: | bronchodilator, beta2 adrenergic agonist |
Species: |
4932 |
Condition: |
STO1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5558±0.0381131 |
Normalized OD Score: sc h |
0.9896±0.0187502 |
Z-Score: |
-0.3657±0.660897 |
p-Value: |
0.661948 |
Z-Factor: |
-12.4849 |
Fitness Defect: |
0.4126 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 22|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.40 Celcius | Date: | 2007-12-06 YYYY-MM-DD | Plate CH Control (+): | 0.042075±0.00137 | Plate DMSO Control (-): | 0.533775±0.01656 | Plate Z-Factor: | 0.8715 |
| png ps pdf |
2783 |
1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |
30849 |
[2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium chloride |
217246 |
1-(4-amino-3,5-dichloro-phenyl)-2-(propan-2-ylamino)ethanol |
688427 |
(1R)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |
688428 |
(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |
5231296 |
[2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 | |
|